Benzo[d]isoxazole-5-sulfonyl chloride, 98%
cas: 16331-62-7 — see every product listed under this CAS number, including other names
Benzo[d]isoxazole-5-sulfonyl chloride, 98% (CAS 16331-62-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F317534-100MG |
| cas | 16331-62-7 |
| size | 100mg |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 924.69 Pln | |
| Fluorochem | 5g | 3387.37 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 909.94 Pln | |
| Ambeed | 5g | 3329.62 Pln | |
| Ambeed | 10g | 4948.31 Pln | |
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 1g | 942.80 Pln | |
| Chemat | 5g | 3141.20 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
1,2-benzoxazole-5-sulfonyl chloride (CAS 16331-62-7) is a chemical compound with the molecular formula C7H4ClNO3S and a molecular weight of 217.63 g/mol. IUPAC name: 1,2-benzoxazole-5-sulfonyl chloride. InChIKey: VOTYKHCJXKHHEQ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3S |
|---|---|
| Molecular weight | 217.63 g/mol |
| IUPAC name | 1,2-benzoxazole-5-sulfonyl chloride |
| InChIKey | VOTYKHCJXKHHEQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)Cl)C=NO2 |
Computed by PubChem (NCBI)