Products 1132-69-0
CAS 1132-69-0 is the registry number for O-(4-Nitrophenyl) carbonochloridothioate, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
O-(4-nitrophenyl) chloromethanethioate (CAS 1132-69-0) is a chemical compound with the molecular formula C7H4ClNO3S and a molecular weight of 217.63 g/mol. IUPAC name: O-(4-nitrophenyl) chloromethanethioate. InChIKey: UHQPEESVLYUICU-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3S |
|---|---|
| Molecular weight | 217.63 g/mol |
| IUPAC name | O-(4-nitrophenyl) chloromethanethioate |
| InChIKey | UHQPEESVLYUICU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC(=S)Cl |
Computed by PubChem (NCBI)