Benzo[de]isochromen-1(3H)-one, 95%
cas: 518-86-5 — see every product listed under this CAS number, including other names
Benzo[de]isochromen-1(3H)-one, 95% (CAS 518-86-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A780849-100mg |
| cas | 518-86-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 592.88 Pln | |
| Ambeed | 250mg | 948.88 Pln | |
| Ambeed | 1g | 2473.00 Pln | |
| Ambeed | 5g | 10950.25 Pln | |
| Chemat | 100mg | 875.60 Pln | |
| Chemat | 250mg | 1446.80 Pln | |
| Chemat | 1g | 3774.80 Pln | |
| Chemat | 5g | 14915.60 Pln | |
| BLDpharm | 100mg | 636.47 Pln | |
| BLDpharm | 250mg | 1019.67 Pln | |
| BLDpharm | 1g | 2657.98 Pln | |
| BLDpharm | 5g | 11799.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-2-one (CAS 518-86-5) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: 3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-2-one. InChIKey: UKOVZLWSUZKTRL-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-2-one |
| InChIKey | UKOVZLWSUZKTRL-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC3=C2C(=CC=C3)C(=O)O1 |
Computed by PubChem (NCBI)