Products 5060-65-1
CAS 5060-65-1 appears in our catalog under these names: Naphthalene–2,6–dicarbaldehyde, Naphthalene-2,6-dicarbaldehyde, Naphthalene-2,6-dicarbaldehyde 97%, 2,6-Naphthalenedicarboxaldehyde, 97%, 97%, Naphthalene-2,6-dicarbaldehyde, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g.
Naphthalene-2,6-dicarbaldehyde (CAS 5060-65-1) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: naphthalene-2,6-dicarbaldehyde. InChIKey: IQDQMRZGMILNMQ-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | naphthalene-2,6-dicarbaldehyde |
| InChIKey | IQDQMRZGMILNMQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C=O)C=C1C=O |
Computed by PubChem (NCBI)