cas: 5153-73-1 — see every product listed under this CAS number, including other names
Benzonitrile, 4-[(1E)-2-nitroethenyl]-, 98%, 98% (CAS 5153-73-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CZ7-250mg |
| cas | 5153-73-1 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 486.80 Pln | |
| Chemat | 5g | 1230.80 Pln | |
| Chemat | 10g | 1821.20 Pln | |
| Chemat | 25g | 3592.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[(E)-2-nitroethenyl]benzonitrile (CAS 5153-73-1) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 4-[(E)-2-nitroethenyl]benzonitrile. InChIKey: CVWPMONBGNBYCJ-AATRIKPKSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 4-[(E)-2-nitroethenyl]benzonitrile |
| InChIKey | CVWPMONBGNBYCJ-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1/C=C/[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)