cas: 77513-40-7 — see every product listed under this CAS number, including other names
Benzyl 3-hydroxybenzoate (CAS 77513-40-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F692248-100MG |
| cas | 77513-40-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 747.67 Pln | |
| Fluorochem | 5g | 2819.86 Pln |
| delivery time | 3-4 weeks |
|---|
Benzyl 3-hydroxybenzoate (CAS 77513-40-7) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: benzyl 3-hydroxybenzoate. InChIKey: QCLMZTCDRVMSHA-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | benzyl 3-hydroxybenzoate |
| InChIKey | QCLMZTCDRVMSHA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)