cas: 78287-52-2 — see every product listed under this CAS number, including other names
Benzyl 4-aminobutanoate hydrochloride 95% (CAS 78287-52-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A2674497-1g |
| cas | 78287-52-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 342.56 Pln | |
| Ambeed | 10g | 609.56 Pln | |
| Ambeed | 25g | 1171.38 Pln | |
| Ambeed | 100g | 3719.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A2674497 |
Benzyl 4-aminobutanoate;hydrochloride (CAS 78287-52-2) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: benzyl 4-aminobutanoate;hydrochloride. InChIKey: RMWDQEXMBCJNFO-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | benzyl 4-aminobutanoate;hydrochloride |
| InChIKey | RMWDQEXMBCJNFO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCCN.Cl |
Computed by PubChem (NCBI)