Products 78287-52-2
CAS 78287-52-2 appears in our catalog under these names: Benzyl 4-aminobutanoate hydrochloride, 97%, Benzyl 4-aminobutanoate hydrochloride, Benzyl 4-aminobutanoate hydrochloride 95%, 4-Aminobenzyl butyrate hydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 25g, 100g, 5g, 1g, 0,25g, 2,5g.
Benzyl 4-aminobutanoate;hydrochloride (CAS 78287-52-2) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: benzyl 4-aminobutanoate;hydrochloride. InChIKey: RMWDQEXMBCJNFO-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | benzyl 4-aminobutanoate;hydrochloride |
| InChIKey | RMWDQEXMBCJNFO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCCN.Cl |
Computed by PubChem (NCBI)