cas: 1210-05-5 — see every product listed under this CAS number, including other names
Biphenyl-2,2'-dicarboxaldehyde, >97.0%(GC) (CAS 1210-05-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B2056-100MG |
| cas | 1210-05-5 |
| size | 100mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 100mg | 605.15 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
2-(2-formylphenyl)benzaldehyde (CAS 1210-05-5) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 2-(2-formylphenyl)benzaldehyde. InChIKey: HJFGULDHUDIPDA-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-(2-formylphenyl)benzaldehyde |
| InChIKey | HJFGULDHUDIPDA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC=CC=C2C=O |
Computed by PubChem (NCBI)