cas: 342-23-4 — see every product listed under this CAS number, including other names
Bis(2-fluorophenyl)methanone 95% (CAS 342-23-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1014078-100mg |
| cas | 342-23-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 487.19 Pln | |
| Ambeed | 250mg | 882.12 Pln | |
| Ambeed | 1g | 2139.25 Pln | |
| Ambeed | 5g | 7012.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1014078 |
Bis(2-fluorophenyl)methanone (CAS 342-23-4) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: bis(2-fluorophenyl)methanone. InChIKey: GNDHXHLGYBJDRD-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | bis(2-fluorophenyl)methanone |
| InChIKey | GNDHXHLGYBJDRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=CC=C2F)F |
Computed by PubChem (NCBI)