cas: 342-23-4 — see every product listed under this CAS number, including other names
Bis(2-fluorophenyl)methanone, 95%, 95% (CAS 342-23-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CUAU-100mg |
| cas | 342-23-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 803.60 Pln | |
| Chemat | 1g | 1874.00 Pln | |
| Chemat | 5g | 6400.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Bis(2-fluorophenyl)methanone (CAS 342-23-4) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: bis(2-fluorophenyl)methanone. InChIKey: GNDHXHLGYBJDRD-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | bis(2-fluorophenyl)methanone |
| InChIKey | GNDHXHLGYBJDRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=CC=C2F)F |
Computed by PubChem (NCBI)