cas: 30992-29-1 — see every product listed under this CAS number, including other names
Boc-Aib-OH 97% (CAS 30992-29-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A202881-5g |
| cas | 30992-29-1 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 170.12 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 220.19 Pln | |
| Ambeed | 500g | 642.94 Pln | |
| Ambeed | 1000g | 1204.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A202881 |
2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 30992-29-1) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: MFNXWZGIFWJHMI-UHFFFAOYSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | MFNXWZGIFWJHMI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C(=O)O |
Computed by PubChem (NCBI)