CAS 30992-29-1 appears in our catalog under these names: Boc-Alpha-Methylalanine, Boc–Aib–OH, Boc-Aib-OH, N-Boc-2-aminoisobutyric acid, 98+% , Boc-a-aminoisobutyric acid. Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 10g, 50g, 500g, 5g, 25g, 1g, 100g, 250g.
2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 30992-29-1) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: MFNXWZGIFWJHMI-UHFFFAOYSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | MFNXWZGIFWJHMI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C(=O)O |
Computed by PubChem (NCBI)