Boc-DL-Tle-OH 98%
cas: 169870-82-0 — see every product listed under this CAS number, including other names
Boc-DL-Tle-OH 98% (CAS 169870-82-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A218623-1g |
| cas | 169870-82-0 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1099.06 Pln | |
| Ambeed | 25g | 2712.19 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A218623 |
3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 169870-82-0) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LRFZIPCTFBPFLX-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | LRFZIPCTFBPFLX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
2-{[(tert-butoxy)carbonyl]amino}-3,3-dimethylbutanoic acid, 2-(((tert-butoxy)carbonyl)amino)-3,3-dimethylbutanoic acid, Boc-Dl-Tle-Oh, 2-((tert-Butoxycarbonyl)amino)-3,3-dimethylbutanoic acid, N-Boc-t-butylglycine, 2-tert-butoxycarbonylamino-3,3-dimethyl-butyric acid, 3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic Acid, N-Boc-DL-tert-leucine, 2-(tert-butoxycarbonylamino)-3,3-dimethylbutanoic acid, boc-tbu-dl-gly-oh