cas: 2419-94-5 — see every product listed under this CAS number, including other names
Boc-Glu-OH, 95%, 95% (CAS 2419-94-5) is a chemical reagent available from Chemat. Available pack sizes: 250g, 1kg, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117X6N-250g |
| cas | 2419-94-5 |
| size | 250g |
| availability | 1200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 333.20 Pln | |
| Chemat | 1kg | 1259.60 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 102.80 Pln | |
| Chemat | 100g | 170.00 Pln | |
| Chemat | 500g | 672.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioic acid (CAS 2419-94-5) is a chemical compound with the molecular formula C10H17NO6 and a molecular weight of 247.24 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioic acid. InChIKey: AQTUACKQXJNHFQ-LURJTMIESA-N.
| Molecular formula | C10H17NO6 |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioic acid |
| InChIKey | AQTUACKQXJNHFQ-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)