CAS 856417-64-6 appears in our catalog under these names: 2-((tert-Butoxycarbonyl)amino)-4-methoxy-4-oxobutanoic acid, 95%, 2–(tert–Butoxycarbonyl)–4–methoxy–4–oxobutanoic acid, 2-((TERT-BUTOXYCARBONYL)AMINO)-4-METHOXY-4-OXOBUTANOIC ACID, 97%, 97%, 2-((tert-Butoxycarbonyl)amino)-4-methoxy-4-oxobutanoic acid, 97%, Boc-DL-Asp(OMe)-OH, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg, 25g, 100g.
4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 856417-64-6) is a chemical compound with the molecular formula C10H17NO6 and a molecular weight of 247.24 g/mol. IUPAC name: 4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: WFPSMPYVXFVVFA-UHFFFAOYSA-N.
| Molecular formula | C10H17NO6 |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | 4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | WFPSMPYVXFVVFA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)OC)C(=O)O |
Computed by PubChem (NCBI)