CAS 137130-65-5 appears in our catalog under these names: Boc–D–Asp–OMe, N-Boc-D-aspartic acid 1-methyl ester, 97% , N-((1,1-Dimethylethoxy)carbonyl)-D-aspartic Acid 1-Methyl Ester, N-Boc-D-aspartic acid 1-methyl ester, 97%, 97%, Boc-D-Asp-OMe, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 50g, 10g, 500g.
(3R)-4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 137130-65-5) is a chemical compound with the molecular formula C10H17NO6 and a molecular weight of 247.24 g/mol. IUPAC name: (3R)-4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: IWFIVTBTZUCTQH-ZCFIWIBFSA-N.
| Molecular formula | C10H17NO6 |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | (3R)-4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | IWFIVTBTZUCTQH-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C(=O)OC |
Computed by PubChem (NCBI)