CAS 2419-94-5 appears in our catalog under these names: Boc–Glu–OH, Boc-L-Glu-OH, N-(tert-Butoxycarbonyl)-L-glutamic Acid, >98.0%(T), Boc-Glu-OH 95%, BOC-GLU-OH, >=98.0%. Offered by: GLPBio, Iris Biotech, Biosynth, TCI, Ambeed. Available pack sizes: 100g, 500g, 25g, 50g, 250g, 1000g, 5g, 10g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioic acid (CAS 2419-94-5) is a chemical compound with the molecular formula C10H17NO6 and a molecular weight of 247.24 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioic acid. InChIKey: AQTUACKQXJNHFQ-LURJTMIESA-N.
| Molecular formula | C10H17NO6 |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioic acid |
| InChIKey | AQTUACKQXJNHFQ-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)