CAS 137401-45-7 appears in our catalog under these names: 2–((tert–Butoxycarbonyl)amino)–3–ethoxy–3–oxopropanoic acid, 2-((tert-Butoxycarbonyl)amino)-3-ethoxy-3-oxopropanoic acid, 97%, 97%, 2-tert-Butoxycarbonylaminomalonic acid monoethyl ester, 95%, Boc-DL-2-COOH-Gly-OEt, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 50g, 100g, 500g.
3-ethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropanoic acid (CAS 137401-45-7) is a chemical compound with the molecular formula C10H17NO6 and a molecular weight of 247.24 g/mol. IUPAC name: 3-ethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropanoic acid. InChIKey: JLNKUZUBBRTYOA-UHFFFAOYSA-N.
| Molecular formula | C10H17NO6 |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | 3-ethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropanoic acid |
| InChIKey | JLNKUZUBBRTYOA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)