CAS 124184-67-4 appears in our catalog under these names: (R)-2-((tert-Butoxycarbonyl)amino)-4-methoxy-4-oxobutanoic acid, 95%, Boc–D–Asp(OMe)–OH, Boc-D-Asp(OMe)-OH, D-Aspartic acid,N-[(1,1-dimethylethoxy)carbonyl]-, 4-methyl ester, 98%, 98%, Boc-D-Asp(OMe)-OH, 95%. Offered by: Fluorochem, GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 250mg, 1g, 50g.
(2R)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 124184-67-4) is a chemical compound with the molecular formula C10H17NO6 and a molecular weight of 247.24 g/mol. IUPAC name: (2R)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: WFPSMPYVXFVVFA-ZCFIWIBFSA-N.
| Molecular formula | C10H17NO6 |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | (2R)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | WFPSMPYVXFVVFA-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)OC)C(=O)O |
Computed by PubChem (NCBI)