CAS 34404-28-9 appears in our catalog under these names: N-Boc-D-glutamic acid, 98% , N-(tert-Butoxycarbonyl)-D-glutamic Acid, >97.0%(HPLC)(T), (R)-2-((tert-Butoxycarbonyl)amino)pentanedioic acid, 95%, 95%, BOC-D-GLU-OH, 97.0%, (R)-2-((tert-Butoxycarbonyl)amino)pentanedioic acid, 95%. Offered by: Thermo Scientific (Alfa Aesar), TCI, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 25g, 10g, 100g, 500g, 25 g, 100 g, 500 g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioic acid (CAS 34404-28-9) is a chemical compound with the molecular formula C10H17NO6 and a molecular weight of 247.24 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioic acid. InChIKey: AQTUACKQXJNHFQ-ZCFIWIBFSA-N.
| Molecular formula | C10H17NO6 |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioic acid |
| InChIKey | AQTUACKQXJNHFQ-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)