CAS 59768-74-0 appears in our catalog under these names: Boc-L-aspartic Acid beta-Methyl Ester, >95% (HPLC), Boc–Asp(OMe)–OH·DCHA, BOC-ASP(OME)-OH, >=98.0%, (S)-2-(tert-Butoxycarbonylamino)-4-methoxy-4-oxobutanoic acid, 98%, 98%, Boc-Asp(OMe)-OH, 99.0%. Offered by: TRC, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 25g, 100g, 500g, 5G, 1g, 10g, 50g, 500 g.
(2S)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 59768-74-0) is a chemical compound with the molecular formula C10H17NO6 and a molecular weight of 247.24 g/mol. IUPAC name: (2S)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: WFPSMPYVXFVVFA-LURJTMIESA-N.
| Molecular formula | C10H17NO6 |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | (2S)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | WFPSMPYVXFVVFA-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OC)C(=O)O |
Computed by PubChem (NCBI)