cas: 64263-80-5 — see every product listed under this CAS number, including other names
Boc-MeThr(Bzl)-OH, 98%, 98% (CAS 64263-80-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114OHU-1g |
| cas | 64263-80-5 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 170.00 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S,3R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylmethoxybutanoic acid (CAS 64263-80-5) is a chemical compound with the molecular formula C17H25NO5 and a molecular weight of 323.4 g/mol. IUPAC name: (2S,3R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylmethoxybutanoic acid. InChIKey: DMYNYZJGZSJUGU-OCCSQVGLSA-N.
| Molecular formula | C17H25NO5 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | (2S,3R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylmethoxybutanoic acid |
| InChIKey | DMYNYZJGZSJUGU-OCCSQVGLSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N(C)C(=O)OC(C)(C)C)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)