CAS 52785-41-8 is the registry number for Linaclotide Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)butanoate (CAS 52785-41-8) is a chemical compound with the molecular formula C17H25NO5 and a molecular weight of 323.4 g/mol. IUPAC name: methyl (2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: NKWFWFWEJCKORD-OCCSQVGLSA-N.
| Molecular formula | C17H25NO5 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | methyl (2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | NKWFWFWEJCKORD-OCCSQVGLSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1)OC(C)(C)C |
Computed by PubChem (NCBI)