Products 1295644-51-7

CAS 1295644-51-7 is the registry number for Cbz-n-amido-peg1-t-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 3-[2-(phenylmethoxycarbonylamino)ethoxy]propanoate (CAS 1295644-51-7) is a chemical compound with the molecular formula C17H25NO5 and a molecular weight of 323.4 g/mol. IUPAC name: tert-butyl 3-[2-(phenylmethoxycarbonylamino)ethoxy]propanoate. InChIKey: WNTDHYXWTOORKJ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H25NO5
Molecular weight323.4 g/mol
IUPAC nametert-butyl 3-[2-(phenylmethoxycarbonylamino)ethoxy]propanoate
InChIKeyWNTDHYXWTOORKJ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)CCOCCNC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)