CAS 64263-80-5 appears in our catalog under these names: Boc–N–Me–Thr(Bzl)–OH · CHA, Boc-(Me)Thr(Bzl)-OH, 98%, Boc-N-Me-Thr(Bzl)-OH, 98%, Boc-MeThr(Bzl)-OH, 98%, 98%, Boc-L-MeThr(Bzl)-OH*CHA. Offered by: GLPBio, Combi-blocks, AmBeed, Chemat, Iris Biotech. Available pack sizes: 5g, 10g, 25g, 1g, 100mg, 250mg.
(2S,3R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylmethoxybutanoic acid (CAS 64263-80-5) is a chemical compound with the molecular formula C17H25NO5 and a molecular weight of 323.4 g/mol. IUPAC name: (2S,3R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylmethoxybutanoic acid. InChIKey: DMYNYZJGZSJUGU-OCCSQVGLSA-N.
| Molecular formula | C17H25NO5 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | (2S,3R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylmethoxybutanoic acid |
| InChIKey | DMYNYZJGZSJUGU-OCCSQVGLSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N(C)C(=O)OC(C)(C)C)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)