CAS 2570172-36-8 is the registry number for Methyl (2R)-2-{[(tert-butoxy)carbonyl]amino}-2-(4-isopropoxyphenyl)acetate, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-propan-2-yloxyphenyl)acetate (CAS 2570172-36-8) is a chemical compound with the molecular formula C17H25NO5 and a molecular weight of 323.4 g/mol. IUPAC name: methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-propan-2-yloxyphenyl)acetate. InChIKey: MJWQINIWXOWVRH-CQSZACIVSA-N.
| Molecular formula | C17H25NO5 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-propan-2-yloxyphenyl)acetate |
| InChIKey | MJWQINIWXOWVRH-CQSZACIVSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)[C@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)