Products 42417-73-2
CAS 42417-73-2 appears in our catalog under these names: Z-N-Me-Thr(tBu)-OH · CHA, Z–N–Me–Thr(tBu)–OH · CHA, Z-N-Me-Thr(tBu)-OH·CHA. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 2000mg, 5000mg, 10000mg.
(2S,3S)-2-[methyl(phenylmethoxycarbonyl)amino]-3-[(2-methylpropan-2-yl)oxy]butanoic acid (CAS 42417-73-2) is a chemical compound with the molecular formula C17H25NO5 and a molecular weight of 323.4 g/mol. IUPAC name: (2S,3S)-2-[methyl(phenylmethoxycarbonyl)amino]-3-[(2-methylpropan-2-yl)oxy]butanoic acid. InChIKey: WWEKEHTZYCKVQB-JSGCOSHPSA-N.
| Molecular formula | C17H25NO5 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | (2S,3S)-2-[methyl(phenylmethoxycarbonyl)amino]-3-[(2-methylpropan-2-yl)oxy]butanoic acid |
| InChIKey | WWEKEHTZYCKVQB-JSGCOSHPSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)O)N(C)C(=O)OCC1=CC=CC=C1)OC(C)(C)C |
Computed by PubChem (NCBI)