CAS 2173146-31-9 appears in our catalog under these names: Saxagliptin Impurity 47, Saxagliptin Impurity 34, (alphaS)-alpha-(((1,1-Dimethylethoxy)carbonyl)amino)-4-oxotricyclo(3.3.1.13,7)decane-1-acetic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-oxo-1-adamantyl)acetic acid (CAS 2173146-31-9) is a chemical compound with the molecular formula C17H25NO5 and a molecular weight of 323.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-oxo-1-adamantyl)acetic acid. InChIKey: FZQIFLCIPLFLQU-AOCZCRFVSA-N.
| Molecular formula | C17H25NO5 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-oxo-1-adamantyl)acetic acid |
| InChIKey | FZQIFLCIPLFLQU-AOCZCRFVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)O)C12CC3CC(C1)C(=O)C(C3)C2 |
Computed by PubChem (NCBI)