CAS 137719-70-1 is the registry number for methyl (2S,3R)-3-(benzyloxy)-2-{[(tert-butoxy)carbonyl]amino}butanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl (2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanoate (CAS 137719-70-1) is a chemical compound with the molecular formula C17H25NO5 and a molecular weight of 323.4 g/mol. IUPAC name: methyl (2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanoate. InChIKey: IJAKSQLBNQCXRA-OCCSQVGLSA-N.
| Molecular formula | C17H25NO5 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | methyl (2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanoate |
| InChIKey | IJAKSQLBNQCXRA-OCCSQVGLSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC)NC(=O)OC(C)(C)C)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)