cas: 16948-16-6 — see every product listed under this CAS number, including other names
Boc-N-Me-Ala-OH, 98% (CAS 16948-16-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A139244-1g |
| cas | 16948-16-6 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 420.44 Pln | |
| Ambeed | 500g | 1811.06 Pln | |
| Ambeed | 1kg | 3541.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (CAS 16948-16-6) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid. InChIKey: VLHQXRIIQSTJCQ-LURJTMIESA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| InChIKey | VLHQXRIIQSTJCQ-LURJTMIESA-N |
| SMILES | C[C@@H](C(=O)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)