CAS 13734-31-1 appears in our catalog under these names: 2–((tert–Butoxycarbonyl)(methyl)amino)propanoic acid, Boc-N-Me-DL-Ala-OH 97%, N-Boc-N-methyl-DL-alanine, 97%, 97%, 2-((tert-Butoxycarbonyl)(methyl)amino)propanoic acid, 97.0%, 2-((tert-Butoxycarbonyl)(methyl)amino)propanoic acid, 96%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 100g, 25g, 250mg, 1g, 5g, 10 g, 100 g.
2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (CAS 13734-31-1) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid. InChIKey: VLHQXRIIQSTJCQ-UHFFFAOYSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| InChIKey | VLHQXRIIQSTJCQ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)