cas: 1365655-91-9 — see every product listed under this CAS number, including other names
Boc-NH-PEG2-CH2CH2COOH 95% (CAS 1365655-91-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A192040-250mg |
| cas | 1365655-91-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 637.38 Pln | |
| Ambeed | 25g | 2267.19 Pln | |
| Ambeed | 100g | 7295.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A192040 |
3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid (CAS 1365655-91-9) is a chemical compound with the molecular formula C12H23NO6 and a molecular weight of 277.31 g/mol. IUPAC name: 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid. InChIKey: OZMXZVCAXAQCHJ-UHFFFAOYSA-N.
| Molecular formula | C12H23NO6 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid |
| InChIKey | OZMXZVCAXAQCHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)