cas: 198474-90-7 — see every product listed under this CAS number, including other names
Boc-Phe(3,4-DiF)-OH, 98%, 98% (CAS 198474-90-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 100g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113BJV-100mg |
| cas | 198474-90-7 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 100g | 5531.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 25g | 1773.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 198474-90-7) is a chemical compound with the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. IUPAC name: (2S)-3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: CYAOPVHXASZUDE-NSHDSACASA-N.
| Molecular formula | C14H17F2NO4 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | (2S)-3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | CYAOPVHXASZUDE-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=C(C=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)