cas: 2121511-38-2 — see every product listed under this CAS number, including other names
Boronic acid, B-(2-fluoro-3,6-dimethoxyphenyl)-, ≥95%, ≥95% (CAS 2121511-38-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K6H4-1g |
| cas | 2121511-38-2 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1754.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(2-fluoro-3,6-dimethoxyphenyl)boronic acid (CAS 2121511-38-2) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (2-fluoro-3,6-dimethoxyphenyl)boronic acid. InChIKey: ZYIRUPNSDJXFPM-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (2-fluoro-3,6-dimethoxyphenyl)boronic acid |
| InChIKey | ZYIRUPNSDJXFPM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OC)OC)(O)O |
Computed by PubChem (NCBI)