cas: 80-44-4 — see every product listed under this CAS number, including other names
Butyl benzenesulfonate 98% (CAS 80-44-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A844665-5g |
| cas | 80-44-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 186.81 Pln | |
| Ambeed | 25g | 464.94 Pln | |
| Ambeed | 100g | 1354.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A844665 |
Butyl benzenesulfonate (CAS 80-44-4) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: butyl benzenesulfonate. InChIKey: NIKBCKTWWPVAIC-UHFFFAOYSA-N.
| Molecular formula | C10H14O3S |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | butyl benzenesulfonate |
| InChIKey | NIKBCKTWWPVAIC-UHFFFAOYSA-N |
| SMILES | CCCCOS(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)