CAS 599-91-7 appears in our catalog under these names: Propyl p-Toluenesulfonate, PPropyl P-toluenesulfonate, Propyl p–Toluenesulfonate, Propyl toluene-4-sulphonate, Propyl p-Toluenesulfonate, >98.0%(GC). Offered by: Chemat Brand, GLPBio, Biosynth, TCI, Thermo Scientific (Acros). Available pack sizes: on request, 100ml, 500ml, 5g, 0,5g, 25ml, 25g, 100g.
Propyl 4-methylbenzenesulfonate (CAS 599-91-7) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: propyl 4-methylbenzenesulfonate. InChIKey: JTTWNTXHFYNETH-UHFFFAOYSA-N.
| Molecular formula | C10H14O3S |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | propyl 4-methylbenzenesulfonate |
| InChIKey | JTTWNTXHFYNETH-UHFFFAOYSA-N |
| SMILES | CCCOS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)