CAS 70920-59-1 appears in our catalog under these names: Methyl 2,4,6-trimethylbenzenesulfonate, 97%, Methyl 2,4,6-trimethylbenzenesulfonate 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
Methyl 2,4,6-trimethylbenzenesulfonate (CAS 70920-59-1) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: methyl 2,4,6-trimethylbenzenesulfonate. InChIKey: VCXKHPUXNZJDDG-UHFFFAOYSA-N.
| Molecular formula | C10H14O3S |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | methyl 2,4,6-trimethylbenzenesulfonate |
| InChIKey | VCXKHPUXNZJDDG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)OC)C |
Computed by PubChem (NCBI)