CAS 4681-78-1 is the registry number for 2,3,5,6-Tetramethylbenzenesulfonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3,5,6-tetramethylbenzenesulfonic acid (CAS 4681-78-1) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: 2,3,5,6-tetramethylbenzenesulfonic acid. InChIKey: KJJMOCUMRBSKTE-UHFFFAOYSA-N.
| Molecular formula | C10H14O3S |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | 2,3,5,6-tetramethylbenzenesulfonic acid |
| InChIKey | KJJMOCUMRBSKTE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)O)C)C |
Computed by PubChem (NCBI)