Products 4681-78-1

CAS 4681-78-1 is the registry number for 2,3,5,6-Tetramethylbenzenesulfonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,3,5,6-tetramethylbenzenesulfonic acid (CAS 4681-78-1) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: 2,3,5,6-tetramethylbenzenesulfonic acid. InChIKey: KJJMOCUMRBSKTE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14O3S
Molecular weight214.28 g/mol
IUPAC name2,3,5,6-tetramethylbenzenesulfonic acid
InChIKeyKJJMOCUMRBSKTE-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1C)S(=O)(=O)O)C)C

Computed by PubChem (NCBI)