CAS 1133-17-1 appears in our catalog under these names: 4-tert-Butyl-Benzenesulfonic Acid, 4-(tert-Butyl)benzenesulfonic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 750mg.
4-tert-butylbenzenesulfonic acid (CAS 1133-17-1) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: 4-tert-butylbenzenesulfonic acid. InChIKey: LZQMCUIWYRQLOG-UHFFFAOYSA-N.
| Molecular formula | C10H14O3S |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | 4-tert-butylbenzenesulfonic acid |
| InChIKey | LZQMCUIWYRQLOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)