CAS 1158976-91-0 is the registry number for 4-(2-Methylpropanesulfonyl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(2-methylpropylsulfonyl)phenol (CAS 1158976-91-0) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: 4-(2-methylpropylsulfonyl)phenol. InChIKey: LRSOIINFIJUUMK-UHFFFAOYSA-N.
| Molecular formula | C10H14O3S |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | 4-(2-methylpropylsulfonyl)phenol |
| InChIKey | LRSOIINFIJUUMK-UHFFFAOYSA-N |
| SMILES | CC(C)CS(=O)(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)