CAS 80-44-4 appears in our catalog under these names: n-butyl Benzenesulfonate, Butyl Benzenesulfonate, Butyl Benzenesulfonate, Butyl Benzenesulfonate, >98.0%(GC), Butyl benzenesulfonate 98%. Offered by: Chemat Brand, TRC, GLPBio, TCI, Ambeed. Available pack sizes: on request, 2,5g, 250mg, 25ml, 5g, 25g, 100g.
Butyl benzenesulfonate (CAS 80-44-4) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: butyl benzenesulfonate. InChIKey: NIKBCKTWWPVAIC-UHFFFAOYSA-N.
| Molecular formula | C10H14O3S |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | butyl benzenesulfonate |
| InChIKey | NIKBCKTWWPVAIC-UHFFFAOYSA-N |
| SMILES | CCCCOS(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)