Products 1400690-42-7

CAS 1400690-42-7 is the registry number for 5-Hydroxymethyl-thiophene-2-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 5-(hydroxymethyl)thiophene-2-carboxylate (CAS 1400690-42-7) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: tert-butyl 5-(hydroxymethyl)thiophene-2-carboxylate. InChIKey: QEKLFPINNYIYJL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14O3S
Molecular weight214.28 g/mol
IUPAC nametert-butyl 5-(hydroxymethyl)thiophene-2-carboxylate
InChIKeyQEKLFPINNYIYJL-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=CC=C(S1)CO

Computed by PubChem (NCBI)