cas: 63648-73-7 — see every product listed under this CAS number, including other names
Cbz-D-Glu-OH 98% (CAS 63648-73-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A215970-5g |
| cas | 63648-73-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 437.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A215970 |
(2R)-2-(phenylmethoxycarbonylamino)pentanedioic acid (CAS 63648-73-7) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: (2R)-2-(phenylmethoxycarbonylamino)pentanedioic acid. InChIKey: PVFCXMDXBIEMQG-SNVBAGLBSA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (2R)-2-(phenylmethoxycarbonylamino)pentanedioic acid |
| InChIKey | PVFCXMDXBIEMQG-SNVBAGLBSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)