cas: 63648-73-7 — see every product listed under this CAS number, including other names
D-Glutamic acid, N-[(phenylmethoxy)carbonyl]-, 98%, 98% (CAS 63648-73-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IB9Z-1g |
| cas | 63648-73-7 |
| size | 1g |
| availability | 175g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 25g | 136.40 Pln | |
| Chemat | 100g | 290.00 Pln | |
| Chemat | 10g | 107.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(phenylmethoxycarbonylamino)pentanedioic acid (CAS 63648-73-7) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: (2R)-2-(phenylmethoxycarbonylamino)pentanedioic acid. InChIKey: PVFCXMDXBIEMQG-SNVBAGLBSA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (2R)-2-(phenylmethoxycarbonylamino)pentanedioic acid |
| InChIKey | PVFCXMDXBIEMQG-SNVBAGLBSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)