cas: 63648-73-7 — see every product listed under this CAS number, including other names
Z-D-Glu-OH, 97.72% (CAS 63648-73-7) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W009329-25 g |
| cas | 63648-73-7 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 263.96 Pln | |
| MedChemExpress | 100 g | 667.99 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.72% |
(2R)-2-(phenylmethoxycarbonylamino)pentanedioic acid (CAS 63648-73-7) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: (2R)-2-(phenylmethoxycarbonylamino)pentanedioic acid. InChIKey: PVFCXMDXBIEMQG-SNVBAGLBSA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (2R)-2-(phenylmethoxycarbonylamino)pentanedioic acid |
| InChIKey | PVFCXMDXBIEMQG-SNVBAGLBSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)