cas: 279261-84-6 — see every product listed under this CAS number, including other names
Chroman-6-ylboronic acid 98+% (CAS 279261-84-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A531692-100mg |
| cas | 279261-84-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 681.88 Pln | |
| Ambeed | 250mg | 1010.06 Pln | |
| Ambeed | 1g | 2400.69 Pln | |
| Ambeed | 5g | 7662.81 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A531692 |
3,4-dihydro-2H-chromen-6-ylboronic acid (CAS 279261-84-6) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: 3,4-dihydro-2H-chromen-6-ylboronic acid. InChIKey: RIBOTMNSYSYOHG-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | 3,4-dihydro-2H-chromen-6-ylboronic acid |
| InChIKey | RIBOTMNSYSYOHG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OCCC2)(O)O |
Computed by PubChem (NCBI)