Products 20007-85-6
CAS 20007-85-6 appears in our catalog under these names: Cyclopenol, (–)–Cyclopenol, (-)-Cyclopenol, (–)-Cyclopenol, ≥95%, Cyclopenol, >=95% (LC/MS-ELSD). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Sigma-Aldrich. Available pack sizes: 1mg, 5mg, 1 mg.
(3S,3'R)-3'-(3-hydroxyphenyl)-4-methylspiro[1H-1,4-benzodiazepine-3,2'-oxirane]-2,5-dione (CAS 20007-85-6) is a chemical compound with the molecular formula C17H14N2O4 and a molecular weight of 310.30 g/mol. IUPAC name: (3S,3'R)-3'-(3-hydroxyphenyl)-4-methylspiro[1H-1,4-benzodiazepine-3,2'-oxirane]-2,5-dione. InChIKey: BDDNYDPRCCDQQJ-PBHICJAKSA-N.
| Molecular formula | C17H14N2O4 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | (3S,3'R)-3'-(3-hydroxyphenyl)-4-methylspiro[1H-1,4-benzodiazepine-3,2'-oxirane]-2,5-dione |
| InChIKey | BDDNYDPRCCDQQJ-PBHICJAKSA-N |
| SMILES | CN1C(=O)C2=CC=CC=C2NC(=O)[C@@]13[C@H](O3)C4=CC(=CC=C4)O |
Computed by PubChem (NCBI)