CAS 304000-05-3 appears in our catalog under these names: DAPK-IN-2/ 98.26% (existing batch purity), DAPK–IN–2, 2-(3,4-Dimethoxyphenyl)-4-(pyridin-3-ylmethylene)oxazol-5(4H)-one, ≥98%, ≥98%, DAPK-IN-2, 98.02%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(4E)-2-(3,4-dimethoxyphenyl)-4-(pyridin-3-ylmethylidene)-1,3-oxazol-5-one (CAS 304000-05-3) is a chemical compound with the molecular formula C17H14N2O4 and a molecular weight of 310.30 g/mol. IUPAC name: (4E)-2-(3,4-dimethoxyphenyl)-4-(pyridin-3-ylmethylidene)-1,3-oxazol-5-one. InChIKey: VQKPPWJEZADXST-MDWZMJQESA-N.
| Molecular formula | C17H14N2O4 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | (4E)-2-(3,4-dimethoxyphenyl)-4-(pyridin-3-ylmethylidene)-1,3-oxazol-5-one |
| InChIKey | VQKPPWJEZADXST-MDWZMJQESA-N |
| SMILES | COC1=C(C=C(C=C1)C2=N/C(=C/C3=CN=CC=C3)/C(=O)O2)OC |
Computed by PubChem (NCBI)