cas: 299165-92-7 — see every product listed under this CAS number, including other names
DCAI (CAS 299165-92-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 25 mg. Offered by: TargetMol, MedChemExpress.
| brand | TargetMol |
|---|---|
| catalog number | T23969-1mg |
| cas | 299165-92-7 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 937.32 Pln | |
| TargetMol | 5mg | 1707.62 Pln | |
| TargetMol | 10mg | 2311.90 Pln | |
| TargetMol | 25mg | 3746.30 Pln | |
| TargetMol | 50mg | 5187.40 Pln | |
| TargetMol | 100mg | 7265.76 Pln | |
| TargetMol | 500mg | 14391.89 Pln | |
| MedChemExpress | 25 mg | 2757.79 Pln | |
| MedChemExpress | 100 mg | 5302.70 Pln | |
| MedChemExpress | 10 mg | 1726.82 Pln | |
| MedChemExpress | 5 mg | 1271.71 Pln | |
| MedChemExpress | 50 mg | 3811.98 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 19 days |
2-(4,6-dichloro-2-methyl-1H-indol-3-yl)ethanamine (CAS 299165-92-7) is a chemical compound with the molecular formula C11H12Cl2N2 and a molecular weight of 243.13 g/mol. IUPAC name: 2-(4,6-dichloro-2-methyl-1H-indol-3-yl)ethanamine. InChIKey: JCTJISIFGZHOFY-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2 |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 2-(4,6-dichloro-2-methyl-1H-indol-3-yl)ethanamine |
| InChIKey | JCTJISIFGZHOFY-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=C(C=C2Cl)Cl)CCN |
Computed by PubChem (NCBI)